C21H35NO — CID 166844104
(4Z,5E)-3-[(2R)-2,3-dimethylpentyl]-2-ethyl-5-ethylidene-4-[(Z)-2-methoxypent-2-enylidene]-1H-pyrrole (PubChem CID 166844104) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (4Z,5E)-3-[(2R)-2,3-dimethylpentyl]-2-ethyl-5-ethylidene-4-[(Z)-2-methoxypent-2-enylidene]-1H-pyrrole.
| Compound Name | (4Z,5E)-3-[(2R)-2,3-dimethylpentyl]-2-ethyl-5-ethylidene-4-[(Z)-2-methoxypent-2-enylidene]-1H-pyrrole |
|---|---|
| PubChem CID | 166844104 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (4Z,5E)-3-[(2R)-2,3-dimethylpentyl]-2-ethyl-5-ethylidene-4-[(Z)-2-methoxypent-2-enylidene]-1H-pyrrole |
| SMILES | C/C=c1/[nH]c(CC)c(C[C@@H](C)C(C)CC)/c1=C/C(=C/CC)OC |
| InChI | InChI=1S/C21H35NO/c1-8-12-17(23-7)14-19-18(13-16(6)15(5)9-2)20(10-3)22-21(19)11-4/h11-12,14-16,22H,8-10,13H2,1-7H3/b17-12-,19-14-,21-11+/t15?,16-/m1/s1 |
| InChIKey | WWVYYYUWXGVCHI-GFLVBLQESA-N |
| XLogP | 4.32 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|