About 3-acetylpyridine-2,6-dicarbaldehyde
3-acetylpyridine-2,6-dicarbaldehyde (PubChem CID 166844260) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 3-acetylpyridine-2,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 3-acetylpyridine-2,6-dicarbaldehyde |
| PubChem CID | 166844260 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-acetylpyridine-2,6-dicarbaldehyde |
| SMILES | CC(=O)c1ccc(C=O)nc1C=O |
| InChI | InChI=1S/C9H7NO3/c1-6(13)8-3-2-7(4-11)10-9(8)5-12/h2-5H,1H3 |
| InChIKey | OSADPNSYXUHEPA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-acetylpyridine-2,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylpyridine-2,6-dicarbaldehyde?
The IUPAC name of 3-acetylpyridine-2,6-dicarbaldehyde (CID 166844260) is 3-acetylpyridine-2,6-dicarbaldehyde.
What is the SMILES notation for 3-acetylpyridine-2,6-dicarbaldehyde?
The canonical SMILES for 3-acetylpyridine-2,6-dicarbaldehyde is CC(=O)c1ccc(C=O)nc1C=O.
What is the InChIKey of 3-acetylpyridine-2,6-dicarbaldehyde?
The InChIKey is OSADPNSYXUHEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c1-6(13)8-3-2-7(4-11)10-9(8)5-12/h2-5H,1H3.
What are the key properties of 3-acetylpyridine-2,6-dicarbaldehyde?
3-acetylpyridine-2,6-dicarbaldehyde has a molecular weight of 177.16 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylpyridine-2,6-dicarbaldehyde is sourced from PubChem (CID 166844260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).