C31H29FN2O — CID 166844316
(7E,12E)-12-benzyl-3-[(3-fluorophenyl)methyl]-8-phenyl-6,9,10,11-tetrahydro-1H-pyrazino[1,2-a]azonin-4-one (PubChem CID 166844316) has the molecular formula C31H29FN2O and a molecular weight of 464.58 g/mol. Its IUPAC name is (7E,12E)-12-benzyl-3-[(3-fluorophenyl)methyl]-8-phenyl-6,9,10,11-tetrahydro-1H-pyrazino[1,2-a]azonin-4-one.
| Compound Name | (7E,12E)-12-benzyl-3-[(3-fluorophenyl)methyl]-8-phenyl-6,9,10,11-tetrahydro-1H-pyrazino[1,2-a]azonin-4-one |
|---|---|
| PubChem CID | 166844316 |
| Molecular Formula | C31H29FN2O |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (7E,12E)-12-benzyl-3-[(3-fluorophenyl)methyl]-8-phenyl-6,9,10,11-tetrahydro-1H-pyrazino[1,2-a]azonin-4-one |
| SMILES | O=C1C(Cc2cccc(F)c2)=NC/C2=C(\Cc3ccccc3)CCC/C(c3ccccc3)=C\CN12 |
| InChI | InChI=1S/C31H29FN2O/c32-28-16-7-11-24(20-28)21-29-31(35)34-18-17-26(25-12-5-2-6-13-25)14-8-15-27(30(34)22-33-29)19-23-9-3-1-4-10-23/h1-7,9-13,16-17,20H,8,14-15,18-19,21-22H2/b26-17+,30-27+ |
| InChIKey | ULOFNUZXSGGZRC-KEZOOQSVSA-N |
| XLogP | 6.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |