About 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one
4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one (PubChem CID 166845469) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one |
| PubChem CID | 166845469 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one |
| SMILES | [H]/N=C1/C(C(C)CC)N(CCC)C(=O)N1CCC |
| InChI | InChI=1S/C13H25N3O/c1-5-8-15-11(10(4)7-3)12(14)16(9-6-2)13(15)17/h10-11,14H,5-9H2,1-4H3/b14-12- |
| InChIKey | XDGAJGRHXFTYTQ-OWBHPGMISA-N |
| XLogP | 2.94 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one?
The IUPAC name of 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one (CID 166845469) is 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one.
What is the SMILES notation for 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one?
The canonical SMILES for 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one is [H]/N=C1/C(C(C)CC)N(CCC)C(=O)N1CCC.
What is the InChIKey of 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one?
The InChIKey is XDGAJGRHXFTYTQ-OWBHPGMISA-N. The full InChI is InChI=1S/C13H25N3O/c1-5-8-15-11(10(4)7-3)12(14)16(9-6-2)13(15)17/h10-11,14H,5-9H2,1-4H3/b14-12-.
What are the key properties of 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one?
4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one has a molecular weight of 239.36 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-5-imino-1,3-dipropylimidazolidin-2-one is sourced from PubChem (CID 166845469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).