C33H43N3O6 — CID 166846121
2-methyl-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-2-[[(E)-4-[4-[[2-methyl-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]phenyl]methyl]phenyl]but-3-enoyl]amino]propanamide (PubChem CID 166846121) has the molecular formula C33H43N3O6 and a molecular weight of 577.72 g/mol. Its IUPAC name is 2-methyl-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-2-[[(E)-4-[4-[[2-methyl-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]phenyl]methyl]phenyl]but-3-enoyl]amino]propanamide.
| Compound Name | 2-methyl-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-2-[[(E)-4-[4-[[2-methyl-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]phenyl]methyl]phenyl]but-3-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 166846121 |
| Molecular Formula | C33H43N3O6 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 2-methyl-N-[2-[methyl(prop-2-ynyl)amino]ethyl]-2-[[(E)-4-[4-[[2-methyl-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]phenyl]methyl]phenyl]but-3-enoyl]amino]propanamide |
| SMILES | C#CCN(C)CCNC(=O)C(C)(C)NC(=O)C/C=C/c1ccc(Cc2cc([C@@H]3OC[C@@H](O)[C@H](O)C3O)ccc2C)cc1 |
| InChI | InChI=1S/C33H43N3O6/c1-6-17-36(5)18-16-34-32(41)33(3,4)35-28(38)9-7-8-23-11-13-24(14-12-23)19-26-20-25(15-10-22(26)2)31-30(40)29(39)27(37)21-42-31/h1,7-8,10-15,20,27,29-31,37,39-40H,9,16-19,21H2,2-5H3,(H,34,41)(H,35,38)/b8-7+/t27-,29+,30?,31+/m1/s1 |
| InChIKey | LTDCXRMXKZZWJD-UTGJZPGUSA-N |
| XLogP | 1.72 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|