C28H27F3N8O3 — CID 166846365
6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-N-[4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide (PubChem CID 166846365) has the molecular formula C28H27F3N8O3 and a molecular weight of 580.57 g/mol. Its IUPAC name is 6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-N-[4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide.
| Compound Name | 6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-N-[4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 166846365 |
| Molecular Formula | C28H27F3N8O3 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-N-[4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)CO)CC2)cc1)c1nnc2cnc(N3C[C@@H](F)C[C@@H]3c3cc(F)ccc3F)cn12 |
| InChI | InChI=1S/C28H27F3N8O3/c29-17-1-6-22(31)21(11-17)23-12-18(30)14-38(23)25-15-39-24(13-32-25)34-35-27(39)28(42)33-19-2-4-20(5-3-19)36-7-9-37(10-8-36)26(41)16-40/h1-6,11,13,15,18,23,40H,7-10,12,14,16H2,(H,33,42)/t18-,23+/m0/s1 |
| InChIKey | JAQXHRRVMUWIPT-FDDCHVKYSA-N |
| XLogP | 2.59 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|