About 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine
6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine (PubChem CID 166846738) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine.
Molecular Properties
| Compound Name | 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine |
| PubChem CID | 166846738 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine |
| SMILES | COC(C)C1CNC(N)CN(C)C1 |
| InChI | InChI=1S/C9H21N3O/c1-7(13-3)8-4-11-9(10)6-12(2)5-8/h7-9,11H,4-6,10H2,1-3H3 |
| InChIKey | UUQKIRVEBPBNQY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine?
The IUPAC name of 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine (CID 166846738) is 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine.
What is the SMILES notation for 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine?
The canonical SMILES for 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine is COC(C)C1CNC(N)CN(C)C1.
What is the InChIKey of 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine?
The InChIKey is UUQKIRVEBPBNQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-7(13-3)8-4-11-9(10)6-12(2)5-8/h7-9,11H,4-6,10H2,1-3H3.
What are the key properties of 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine?
6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine has a molecular weight of 187.29 g/mol, XLogP of -0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-methoxyethyl)-4-methyl-1,4-diazepan-2-amine is sourced from PubChem (CID 166846738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).