C9H16BrNO2 — CID 166847030
methyl (4R)-4-bromo-3-methanimidoyl-2,3-dimethylpentanoate (PubChem CID 166847030) has the molecular formula C9H16BrNO2 and a molecular weight of 250.14 g/mol. Its IUPAC name is methyl (4R)-4-bromo-3-methanimidoyl-2,3-dimethylpentanoate.
| Compound Name | methyl (4R)-4-bromo-3-methanimidoyl-2,3-dimethylpentanoate |
|---|---|
| PubChem CID | 166847030 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | methyl (4R)-4-bromo-3-methanimidoyl-2,3-dimethylpentanoate |
| SMILES | [H]/N=C/C(C)(C(C)C(=O)OC)[C@@H](C)Br |
| InChI | InChI=1S/C9H16BrNO2/c1-6(8(12)13-4)9(3,5-11)7(2)10/h5-7,11H,1-4H3/b11-5+/t6?,7-,9?/m1/s1 |
| InChIKey | FSADABLWWVLHKW-LCMYKPIVSA-N |
| XLogP | 2.23 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|