About Aluminum phthalocyanine hydroxide
Aluminum phthalocyanine hydroxide (PubChem CID 16684778) has the molecular formula C32H18AlN8O
and a molecular weight of 557.53 g/mol.
Molecular Properties
| Compound Name | Aluminum phthalocyanine hydroxide |
| PubChem CID | 16684778 |
| Molecular Formula | C32H18AlN8O |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | — |
| SMILES | O.c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Al]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1 |
| InChI | InChI=1S/C32H16N8.Al.H2O/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;/h1-16H;;1H2/q-2;+2; |
| InChIKey | QIXXBAMNGHXZRH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Aluminum phthalocyanine hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aluminum phthalocyanine hydroxide?
The IUPAC name of Aluminum phthalocyanine hydroxide (CID 16684778) is not available.
What is the SMILES notation for Aluminum phthalocyanine hydroxide?
The canonical SMILES for Aluminum phthalocyanine hydroxide is O.c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Al]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1.
What is the InChIKey of Aluminum phthalocyanine hydroxide?
The InChIKey is QIXXBAMNGHXZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H16N8.Al.H2O/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;/h1-16H;;1H2/q-2;+2;.
What are the key properties of Aluminum phthalocyanine hydroxide?
Aluminum phthalocyanine hydroxide has a molecular weight of 557.53 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Aluminum phthalocyanine hydroxide is sourced from PubChem (CID 16684778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).