C25H31ClN6O2 — CID 166848771
(2R,5S)-12-[4-[2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]piperazin-1-yl]-7,9,11-triazatricyclo[6.4.0.02,5]dodeca-1(8),9,11-trien-6-one (PubChem CID 166848771) has the molecular formula C25H31ClN6O2 and a molecular weight of 483.02 g/mol. Its IUPAC name is (2R,5S)-12-[4-[2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]piperazin-1-yl]-7,9,11-triazatricyclo[6.4.0.02,5]dodeca-1(8),9,11-trien-6-one.
| Compound Name | (2R,5S)-12-[4-[2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]piperazin-1-yl]-7,9,11-triazatricyclo[6.4.0.02,5]dodeca-1(8),9,11-trien-6-one |
|---|---|
| PubChem CID | 166848771 |
| Molecular Formula | C25H31ClN6O2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2R,5S)-12-[4-[2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]piperazin-1-yl]-7,9,11-triazatricyclo[6.4.0.02,5]dodeca-1(8),9,11-trien-6-one |
| SMILES | CC(C)NCC(C(=O)N1CCN(c2ncnc3c2[C@@H]2CC[C@@H]2C(=O)N3)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN6O2/c1-15(2)27-13-20(16-3-5-17(26)6-4-16)25(34)32-11-9-31(10-12-32)23-21-18-7-8-19(18)24(33)30-22(21)28-14-29-23/h3-6,14-15,18-20,27H,7-13H2,1-2H3,(H,28,29,30,33)/t18-,19+,20?/m1/s1 |
| InChIKey | IHCUISAZDJFBCK-LFPSWIHMSA-N |
| XLogP | 3.01 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |