C13H13Cl2N3 — CID 166849131
3-(2,5-dichloro-4-pyridinyl)-5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazole (PubChem CID 166849131) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-pyridinyl)-5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazole.
| Compound Name | 3-(2,5-dichloro-4-pyridinyl)-5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazole |
|---|---|
| PubChem CID | 166849131 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-(2,5-dichloro-4-pyridinyl)-5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazole |
| SMILES | CC1(C)Cc2c(-c3cc(Cl)ncc3Cl)cnn2C1 |
| InChI | InChI=1S/C13H13Cl2N3/c1-13(2)4-11-9(5-17-18(11)7-13)8-3-12(15)16-6-10(8)14/h3,5-6H,4,7H2,1-2H3 |
| InChIKey | BNLAXJCZDWLCPQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|