About 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol
1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol (PubChem CID 166849798) has the molecular formula C12H16ClNO
and a molecular weight of 225.72 g/mol. Its IUPAC name is 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol.
Molecular Properties
| Compound Name | 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol |
| PubChem CID | 166849798 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol |
| SMILES | CC(C)(C)N1C=CC2C(O)=C(Cl)C=CC21 |
| InChI | InChI=1S/C12H16ClNO/c1-12(2,3)14-7-6-8-10(14)5-4-9(13)11(8)15/h4-8,10,15H,1-3H3 |
| InChIKey | VFMXMANISVCZAJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol?
The IUPAC name of 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol (CID 166849798) is 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol.
What is the SMILES notation for 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol?
The canonical SMILES for 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol is CC(C)(C)N1C=CC2C(O)=C(Cl)C=CC21.
What is the InChIKey of 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol?
The InChIKey is VFMXMANISVCZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO/c1-12(2,3)14-7-6-8-10(14)5-4-9(13)11(8)15/h4-8,10,15H,1-3H3.
What are the key properties of 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol?
1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol has a molecular weight of 225.72 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-chloro-3a,7a-dihydroindol-4-ol is sourced from PubChem (CID 166849798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).