C24H24O6 — CID 166849905
2-[[3-[3-[3-(2-methoxyethoxy)phenoxy]phenoxy]phenoxy]methyl]oxirane (PubChem CID 166849905) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[[3-[3-[3-(2-methoxyethoxy)phenoxy]phenoxy]phenoxy]methyl]oxirane.
| Compound Name | 2-[[3-[3-[3-(2-methoxyethoxy)phenoxy]phenoxy]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 166849905 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[[3-[3-[3-(2-methoxyethoxy)phenoxy]phenoxy]phenoxy]methyl]oxirane |
| SMILES | COCCOc1cccc(Oc2cccc(Oc3cccc(OCC4CO4)c3)c2)c1 |
| InChI | InChI=1S/C24H24O6/c1-25-11-12-26-18-5-2-7-20(13-18)29-22-9-4-10-23(15-22)30-21-8-3-6-19(14-21)27-16-24-17-28-24/h2-10,13-15,24H,11-12,16-17H2,1H3 |
| InChIKey | VZCQTFWAYROJRY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|