C33H20F3N3O — CID 166850397
2-[4-[6-[4-(3,4,5-trifluorophenyl)phenyl]quinoxalin-2-yl]phenyl]-2,3-dihydro-1,3-benzoxazole (PubChem CID 166850397) has the molecular formula C33H20F3N3O and a molecular weight of 531.54 g/mol. Its IUPAC name is 2-[4-[6-[4-(3,4,5-trifluorophenyl)phenyl]quinoxalin-2-yl]phenyl]-2,3-dihydro-1,3-benzoxazole.
| Compound Name | 2-[4-[6-[4-(3,4,5-trifluorophenyl)phenyl]quinoxalin-2-yl]phenyl]-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 166850397 |
| Molecular Formula | C33H20F3N3O |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-[4-[6-[4-(3,4,5-trifluorophenyl)phenyl]quinoxalin-2-yl]phenyl]-2,3-dihydro-1,3-benzoxazole |
| SMILES | Fc1cc(-c2ccc(-c3ccc4nc(-c5ccc(C6Nc7ccccc7O6)cc5)cnc4c3)cc2)cc(F)c1F |
| InChI | InChI=1S/C33H20F3N3O/c34-25-15-24(16-26(35)32(25)36)20-7-5-19(6-8-20)23-13-14-27-29(17-23)37-18-30(38-27)21-9-11-22(12-10-21)33-39-28-3-1-2-4-31(28)40-33/h1-18,33,39H |
| InChIKey | NZAUGOZFQOZSPH-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|