About Hydroxy gallium phthalocyanine
Hydroxy gallium phthalocyanine (PubChem CID 16685048) has the molecular formula C32H18GaN8O
and a molecular weight of 600.27 g/mol.
Molecular Properties
| Compound Name | Hydroxy gallium phthalocyanine |
| PubChem CID | 16685048 |
| Molecular Formula | C32H18GaN8O |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | — |
| SMILES | O.c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Ga]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1 |
| InChI | InChI=1S/C32H16N8.Ga.H2O/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;/h1-16H;;1H2/q-2;+2; |
| InChIKey | NFPNUFYJUKHNEL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Hydroxy gallium phthalocyanine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydroxy gallium phthalocyanine?
The IUPAC name of Hydroxy gallium phthalocyanine (CID 16685048) is not available.
What is the SMILES notation for Hydroxy gallium phthalocyanine?
The canonical SMILES for Hydroxy gallium phthalocyanine is O.c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Ga]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1.
What is the InChIKey of Hydroxy gallium phthalocyanine?
The InChIKey is NFPNUFYJUKHNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H16N8.Ga.H2O/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;/h1-16H;;1H2/q-2;+2;.
What are the key properties of Hydroxy gallium phthalocyanine?
Hydroxy gallium phthalocyanine has a molecular weight of 600.27 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Hydroxy gallium phthalocyanine is sourced from PubChem (CID 16685048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).