About 6-fluoro-2-methyl-1,8a-dihydroindolizine
6-fluoro-2-methyl-1,8a-dihydroindolizine (PubChem CID 166850488) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,8a-dihydroindolizine.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-1,8a-dihydroindolizine |
| PubChem CID | 166850488 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 6-fluoro-2-methyl-1,8a-dihydroindolizine |
| SMILES | CC1=CN2C=C(F)C=CC2C1 |
| InChI | InChI=1S/C9H10FN/c1-7-4-9-3-2-8(10)6-11(9)5-7/h2-3,5-6,9H,4H2,1H3 |
| InChIKey | VLQAUDMBPNXFAS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2-methyl-1,8a-dihydroindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-1,8a-dihydroindolizine?
The IUPAC name of 6-fluoro-2-methyl-1,8a-dihydroindolizine (CID 166850488) is 6-fluoro-2-methyl-1,8a-dihydroindolizine.
What is the SMILES notation for 6-fluoro-2-methyl-1,8a-dihydroindolizine?
The canonical SMILES for 6-fluoro-2-methyl-1,8a-dihydroindolizine is CC1=CN2C=C(F)C=CC2C1.
What is the InChIKey of 6-fluoro-2-methyl-1,8a-dihydroindolizine?
The InChIKey is VLQAUDMBPNXFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN/c1-7-4-9-3-2-8(10)6-11(9)5-7/h2-3,5-6,9H,4H2,1H3.
What are the key properties of 6-fluoro-2-methyl-1,8a-dihydroindolizine?
6-fluoro-2-methyl-1,8a-dihydroindolizine has a molecular weight of 151.18 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-1,8a-dihydroindolizine is sourced from PubChem (CID 166850488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).