About CID 16685049
CID 16685049 (PubChem CID 16685049) has the molecular formula C32H16GaN8
and a molecular weight of 582.26 g/mol.
Molecular Properties
| Compound Name | CID 16685049 |
| PubChem CID | 16685049 |
| Molecular Formula | C32H16GaN8 |
| Molecular Weight | 582.26 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Ga]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1 |
| InChI | InChI=1S/C32H16N8.Ga/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2 |
| InChIKey | WBSOKGMOXCALAG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 582.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 16685049 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16685049?
The IUPAC name of CID 16685049 (CID 16685049) is not available.
What is the SMILES notation for CID 16685049?
The canonical SMILES for CID 16685049 is c1ccc2c(c1)C1=N/C2=N\c2c3ccccc3c3n2[Ga]n2/c(c4ccccc4/c2=N/C2=N/C(=N\3)c3ccccc32)=N\1.
What is the InChIKey of CID 16685049?
The InChIKey is WBSOKGMOXCALAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H16N8.Ga/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2.
What are the key properties of CID 16685049?
CID 16685049 has a molecular weight of 582.26 g/mol, XLogP of 4.47, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16685049 is sourced from PubChem (CID 16685049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).