About (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one
(4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one (PubChem CID 166850608) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one.
Molecular Properties
| Compound Name | (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one |
| PubChem CID | 166850608 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one |
| SMILES | C/C=C(\CC(C)C)C(=O)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C15H27NO2/c1-6-13(11-12(2)3)14(17)15(4,5)16-7-9-18-10-8-16/h6,12H,7-11H2,1-5H3/b13-6+ |
| InChIKey | MFRYNODJMICSGH-AWNIVKPZSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one?
The IUPAC name of (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one (CID 166850608) is (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one.
What is the SMILES notation for (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one?
The canonical SMILES for (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one is C/C=C(\CC(C)C)C(=O)C(C)(C)N1CCOCC1.
What is the InChIKey of (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one?
The InChIKey is MFRYNODJMICSGH-AWNIVKPZSA-N. The full InChI is InChI=1S/C15H27NO2/c1-6-13(11-12(2)3)14(17)15(4,5)16-7-9-18-10-8-16/h6,12H,7-11H2,1-5H3/b13-6+.
What are the key properties of (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one?
(4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one has a molecular weight of 253.39 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-ethylidene-2,6-dimethyl-2-morpholin-4-ylheptan-3-one is sourced from PubChem (CID 166850608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).