C24H32N6O3 — CID 166850695
N-[(E)-1-[amino(methyl)amino]-3-carbamoylpent-1-en-2-yl]-2-[4-(1H-pyrazol-5-yl)benzoyl]cyclohexane-1-carboxamide (PubChem CID 166850695) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(E)-1-[amino(methyl)amino]-3-carbamoylpent-1-en-2-yl]-2-[4-(1H-pyrazol-5-yl)benzoyl]cyclohexane-1-carboxamide.
| Compound Name | N-[(E)-1-[amino(methyl)amino]-3-carbamoylpent-1-en-2-yl]-2-[4-(1H-pyrazol-5-yl)benzoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166850695 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[(E)-1-[amino(methyl)amino]-3-carbamoylpent-1-en-2-yl]-2-[4-(1H-pyrazol-5-yl)benzoyl]cyclohexane-1-carboxamide |
| SMILES | CCC(C(N)=O)/C(=C\N(C)N)NC(=O)C1CCCCC1C(=O)c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C24H32N6O3/c1-3-17(23(25)32)21(14-30(2)26)28-24(33)19-7-5-4-6-18(19)22(31)16-10-8-15(9-11-16)20-12-13-27-29-20/h8-14,17-19H,3-7,26H2,1-2H3,(H2,25,32)(H,27,29)(H,28,33)/b21-14+ |
| InChIKey | JDYHAFQRSMHTDO-KGENOOAVSA-N |
| XLogP | 2.34 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|