About 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole
5-pyrazol-1-yl-2,3-dihydro-1H-isoindole (PubChem CID 166850817) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole |
| PubChem CID | 166850817 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole |
| SMILES | c1cnn(-c2ccc3c(c2)CNC3)c1 |
| InChI | InChI=1S/C11H11N3/c1-4-13-14(5-1)11-3-2-9-7-12-8-10(9)6-11/h1-6,12H,7-8H2 |
| InChIKey | UAGJILOPAYUDAO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole?
The IUPAC name of 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole (CID 166850817) is 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole?
The canonical SMILES for 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole is c1cnn(-c2ccc3c(c2)CNC3)c1.
What is the InChIKey of 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole?
The InChIKey is UAGJILOPAYUDAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-4-13-14(5-1)11-3-2-9-7-12-8-10(9)6-11/h1-6,12H,7-8H2.
What are the key properties of 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole?
5-pyrazol-1-yl-2,3-dihydro-1H-isoindole has a molecular weight of 185.23 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-yl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 166850817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).