C56H32I2N4O2 — CID 166850961
4-dibenzofuran-4-yl-6-iodo-2-[3-[4-[6-[6-iodo-2-(4-phenylphenyl)pyrimidin-4-yl]dibenzofuran-2-yl]phenyl]phenyl]pyrimidine (PubChem CID 166850961) has the molecular formula C56H32I2N4O2 and a molecular weight of 1046.71 g/mol. Its IUPAC name is 4-dibenzofuran-4-yl-6-iodo-2-[3-[4-[6-[6-iodo-2-(4-phenylphenyl)pyrimidin-4-yl]dibenzofuran-2-yl]phenyl]phenyl]pyrimidine.
| Compound Name | 4-dibenzofuran-4-yl-6-iodo-2-[3-[4-[6-[6-iodo-2-(4-phenylphenyl)pyrimidin-4-yl]dibenzofuran-2-yl]phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 166850961 |
| Molecular Formula | C56H32I2N4O2 |
| Molecular Weight | 1046.71 g/mol |
| Exact Mass | 1046.06 |
| IUPAC Name | 4-dibenzofuran-4-yl-6-iodo-2-[3-[4-[6-[6-iodo-2-(4-phenylphenyl)pyrimidin-4-yl]dibenzofuran-2-yl]phenyl]phenyl]pyrimidine |
| SMILES | Ic1cc(-c2cccc3c2oc2ccccc23)nc(-c2cccc(-c3ccc(-c4ccc5oc6c(-c7cc(I)nc(-c8ccc(-c9ccccc9)cc8)n7)cccc6c5c4)cc3)c2)n1 |
| InChI | InChI=1S/C56H32I2N4O2/c57-51-31-47(59-55(61-51)37-25-23-34(24-26-37)33-9-2-1-3-10-33)45-17-8-15-43-46-30-39(27-28-50(46)64-54(43)45)36-21-19-35(20-22-36)38-11-6-12-40(29-38)56-60-48(32-52(58)62-56)44-16-7-14-42-41-13-4-5-18-49(41)63-53(42)44/h1-32H |
| InChIKey | AVYSSKKECXZNRB-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.71 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|