C50H27I6NO4S3+2 — CID 166851202
(2,4,6-triiodophenyl) 4-[2-[5-[4-(2,4,6-triiodophenoxy)carbonylphenyl]thianthren-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]benzoate (PubChem CID 166851202) has the molecular formula C50H27I6NO4S3+2 and a molecular weight of 1563.39 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 4-[2-[5-[4-(2,4,6-triiodophenoxy)carbonylphenyl]thianthren-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]benzoate.
| Compound Name | (2,4,6-triiodophenyl) 4-[2-[5-[4-(2,4,6-triiodophenoxy)carbonylphenyl]thianthren-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]benzoate |
|---|---|
| PubChem CID | 166851202 |
| Molecular Formula | C50H27I6NO4S3+2 |
| Molecular Weight | 1563.39 g/mol |
| Exact Mass | 1562.54 |
| IUPAC Name | (2,4,6-triiodophenyl) 4-[2-[5-[4-(2,4,6-triiodophenoxy)carbonylphenyl]thianthren-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]benzoate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc([S+]2c3ccccc3Nc3cc(-c4ccc5c(c4)Sc4ccccc4[S+]5c4ccc(C(=O)Oc5c(I)cc(I)cc5I)cc4)ccc32)cc1 |
| InChI | InChI=1S/C50H27I6NO4S3/c51-31-23-35(53)47(36(54)24-31)60-49(58)27-9-15-33(16-10-27)63-43-7-3-1-5-39(43)57-40-21-29(13-19-44(40)63)30-14-20-46-42(22-30)62-41-6-2-4-8-45(41)64(46)34-17-11-28(12-18-34)50(59)61-48-37(55)25-32(52)26-38(48)56/h1-26,57H/q+2 |
| InChIKey | XWMPDFHOSOHADE-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1563.39 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|