C61H48N4O — CID 166851948
3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-6-[4-[(1S,5S)-1,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]phenyl]carbazole (PubChem CID 166851948) has the molecular formula C61H48N4O and a molecular weight of 853.08 g/mol. Its IUPAC name is 3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-6-[4-[(1S,5S)-1,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]phenyl]carbazole.
| Compound Name | 3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-6-[4-[(1S,5S)-1,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]phenyl]carbazole |
|---|---|
| PubChem CID | 166851948 |
| Molecular Formula | C61H48N4O |
| Molecular Weight | 853.08 g/mol |
| Exact Mass | 852.38 |
| IUPAC Name | 3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-6-[4-[(1S,5S)-1,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]phenyl]carbazole |
| SMILES | CC1(C)[C@H]2CCC(c3ccc(-c4ccc5c(c4)c4cc(-c6ccc7oc8cccc(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c8c7c6)ccc4n5-c4ccccc4)cc3)[C@]1(C)C2 |
| InChI | InChI=1S/C61H48N4O/c1-60(2)45-29-30-51(61(60,3)37-45)39-24-22-38(23-25-39)42-26-31-52-48(34-42)49-35-43(27-32-53(49)65(52)46-18-11-6-12-19-46)44-28-33-54-50(36-44)56-47(20-13-21-55(56)66-54)59-63-57(40-14-7-4-8-15-40)62-58(64-59)41-16-9-5-10-17-41/h4-28,31-36,45,51H,29-30,37H2,1-3H3/t45-,51?,61-/m0/s1 |
| InChIKey | LVUXZHMYOYRESB-UYBFCTCRSA-N |
| XLogP | 16.13 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.08 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |