C29H28N2O3 — CID 166851973
4-[(1-ethyl-3,4-dihydroquinolin-1-ium-2-yl)methyl]-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-3,5-dioxocyclopenten-1-olate (PubChem CID 166851973) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[(1-ethyl-3,4-dihydroquinolin-1-ium-2-yl)methyl]-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-3,5-dioxocyclopenten-1-olate.
| Compound Name | 4-[(1-ethyl-3,4-dihydroquinolin-1-ium-2-yl)methyl]-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-3,5-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 166851973 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[(1-ethyl-3,4-dihydroquinolin-1-ium-2-yl)methyl]-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-3,5-dioxocyclopenten-1-olate |
| SMILES | CCN1/C(=C/C2=C([O-])C(=O)C(CC3=[N+](CC)c4ccccc4CC3)C2=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C29H28N2O3/c1-3-30-21(15-13-19-9-5-7-11-25(19)30)17-23-27(32)24(29(34)28(23)33)18-22-16-14-20-10-6-8-12-26(20)31(22)4-2/h5-13,15,17,24H,3-4,14,16,18H2,1-2H3/b21-17+ |
| InChIKey | XIQTWTWKFIQUIW-HEHNFIMWSA-N |
| XLogP | 3.95 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|