C32H39F3N4O4S — CID 166852407
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[1,1-dioxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 166852407) has the molecular formula C32H39F3N4O4S and a molecular weight of 632.75 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[1,1-dioxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[1,1-dioxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 166852407 |
| Molecular Formula | C32H39F3N4O4S |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[1,1-dioxo-8-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | CCN(N)c1ccc(C(c2ccc(C)c(CN3CCCc4ccc(C(F)(F)F)cc4S3(=O)=O)c2)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C32H39F3N4O4S/c1-6-39(37)26-14-13-25(20(3)29(26)36)28(31(4,5)30(40)41)22-10-9-19(2)23(16-22)18-38-15-7-8-21-11-12-24(32(33,34)35)17-27(21)44(38,42)43/h9-14,16-17,28H,6-8,15,18,36-37H2,1-5H3,(H,40,41) |
| InChIKey | OAJFICCUGYEHQW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|