C31H37F3N4O3S — CID 166852551
(3S)-3-[3-amino-4-[amino(ethyl)amino]-5-methoxy-2-methylphenyl]-3-[4-methyl-3-[[8-(trifluoromethyl)-4,5-dihydro-3H-1,2-benzothiazepin-2-yl]methyl]phenyl]propanoic acid (PubChem CID 166852551) has the molecular formula C31H37F3N4O3S and a molecular weight of 602.72 g/mol. Its IUPAC name is (3S)-3-[3-amino-4-[amino(ethyl)amino]-5-methoxy-2-methylphenyl]-3-[4-methyl-3-[[8-(trifluoromethyl)-4,5-dihydro-3H-1,2-benzothiazepin-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | (3S)-3-[3-amino-4-[amino(ethyl)amino]-5-methoxy-2-methylphenyl]-3-[4-methyl-3-[[8-(trifluoromethyl)-4,5-dihydro-3H-1,2-benzothiazepin-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 166852551 |
| Molecular Formula | C31H37F3N4O3S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | (3S)-3-[3-amino-4-[amino(ethyl)amino]-5-methoxy-2-methylphenyl]-3-[4-methyl-3-[[8-(trifluoromethyl)-4,5-dihydro-3H-1,2-benzothiazepin-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CCN(N)c1c(OC)cc([C@@H](CC(=O)O)c2ccc(C)c(CN3CCCc4ccc(C(F)(F)F)cc4S3)c2)c(C)c1N |
| InChI | InChI=1S/C31H37F3N4O3S/c1-5-38(36)30-26(41-4)15-24(19(3)29(30)35)25(16-28(39)40)21-9-8-18(2)22(13-21)17-37-12-6-7-20-10-11-23(31(32,33)34)14-27(20)42-37/h8-11,13-15,25H,5-7,12,16-17,35-36H2,1-4H3,(H,39,40)/t25-/m0/s1 |
| InChIKey | SWMSXLUEOGHURE-VWLOTQADSA-N |
| XLogP | 6.68 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|