C10H19N2P — CID 166852665
5-ethyl-2,3,4,5,6,7,8,9-octahydro-1H-cycloocta[d]diazaphosphole (PubChem CID 166852665) has the molecular formula C10H19N2P and a molecular weight of 198.25 g/mol. Its IUPAC name is 5-ethyl-2,3,4,5,6,7,8,9-octahydro-1H-cycloocta[d]diazaphosphole.
| Compound Name | 5-ethyl-2,3,4,5,6,7,8,9-octahydro-1H-cycloocta[d]diazaphosphole |
|---|---|
| PubChem CID | 166852665 |
| Molecular Formula | C10H19N2P |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 5-ethyl-2,3,4,5,6,7,8,9-octahydro-1H-cycloocta[d]diazaphosphole |
| SMILES | CCC1CCCCC2=C(C1)PNN2 |
| InChI | InChI=1S/C10H19N2P/c1-2-8-5-3-4-6-9-10(7-8)13-12-11-9/h8,11-13H,2-7H2,1H3 |
| InChIKey | NHVLERMNVGJSRT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|