C17H22BrFN2O3 — CID 166852979
[4-(4-bromo-3-fluorocyclohex-2-en-1-yl)-1,3-oxazol-5-yl]methyl N-cyclopentyl-N-methylcarbamate (PubChem CID 166852979) has the molecular formula C17H22BrFN2O3 and a molecular weight of 401.28 g/mol. Its IUPAC name is [4-(4-bromo-3-fluorocyclohex-2-en-1-yl)-1,3-oxazol-5-yl]methyl N-cyclopentyl-N-methylcarbamate.
| Compound Name | [4-(4-bromo-3-fluorocyclohex-2-en-1-yl)-1,3-oxazol-5-yl]methyl N-cyclopentyl-N-methylcarbamate |
|---|---|
| PubChem CID | 166852979 |
| Molecular Formula | C17H22BrFN2O3 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [4-(4-bromo-3-fluorocyclohex-2-en-1-yl)-1,3-oxazol-5-yl]methyl N-cyclopentyl-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ocnc1C1C=C(F)C(Br)CC1)C1CCCC1 |
| InChI | InChI=1S/C17H22BrFN2O3/c1-21(12-4-2-3-5-12)17(22)23-9-15-16(20-10-24-15)11-6-7-13(18)14(19)8-11/h8,10-13H,2-7,9H2,1H3 |
| InChIKey | GGBXZWSDWFRMTM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|