About ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate
ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate (PubChem CID 166852994) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate.
Molecular Properties
| Compound Name | ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate |
| PubChem CID | 166852994 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)CC1C=CC=CC1 |
| InChI | InChI=1S/C11H17NO2/c1-3-14-11(13)12(2)9-10-7-5-4-6-8-10/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | ZVEHSZQXESGZJL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate?
The IUPAC name of ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate (CID 166852994) is ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate.
What is the SMILES notation for ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate?
The canonical SMILES for ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate is CCOC(=O)N(C)CC1C=CC=CC1.
What is the InChIKey of ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate?
The InChIKey is ZVEHSZQXESGZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-3-14-11(13)12(2)9-10-7-5-4-6-8-10/h4-7,10H,3,8-9H2,1-2H3.
What are the key properties of ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate?
ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate has a molecular weight of 195.26 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(cyclohexa-2,4-dien-1-ylmethyl)-N-methylcarbamate is sourced from PubChem (CID 166852994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).