About 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide
3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide (PubChem CID 166853178) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide |
| PubChem CID | 166853178 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide |
| SMILES | CCC(C)N1C=C(C(N)=O)NC1O |
| InChI | InChI=1S/C8H15N3O2/c1-3-5(2)11-4-6(7(9)12)10-8(11)13/h4-5,8,10,13H,3H2,1-2H3,(H2,9,12) |
| InChIKey | ZQRKHLVUWLFLCF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide?
The IUPAC name of 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide (CID 166853178) is 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide.
What is the SMILES notation for 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide?
The canonical SMILES for 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide is CCC(C)N1C=C(C(N)=O)NC1O.
What is the InChIKey of 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide?
The InChIKey is ZQRKHLVUWLFLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-3-5(2)11-4-6(7(9)12)10-8(11)13/h4-5,8,10,13H,3H2,1-2H3,(H2,9,12).
What are the key properties of 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide?
3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide has a molecular weight of 185.23 g/mol, XLogP of -0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-2-hydroxy-1,2-dihydroimidazole-5-carboxamide is sourced from PubChem (CID 166853178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).