About tris[(5,7-dichloroquinolin-8-yl)oxy]alumane
tris[(5,7-dichloroquinolin-8-yl)oxy]alumane (PubChem CID 16685322) has the molecular formula C27H12AlCl6N3O3
and a molecular weight of 666.11 g/mol. Its IUPAC name is tris[(5,7-dichloroquinolin-8-yl)oxy]alumane.
Molecular Properties
| Compound Name | tris[(5,7-dichloroquinolin-8-yl)oxy]alumane |
| PubChem CID | 16685322 |
| Molecular Formula | C27H12AlCl6N3O3 |
| Molecular Weight | 666.11 g/mol |
| Exact Mass | 662.88 |
| IUPAC Name | tris[(5,7-dichloroquinolin-8-yl)oxy]alumane |
| SMILES | Clc1cc(Cl)c2cccnc2c1O[Al](Oc1c(Cl)cc(Cl)c2cccnc12)Oc1c(Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/3C9H5Cl2NO.Al/c3*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h3*1-4,13H;/q;;;+3/p-3 |
| InChIKey | ADGHETHODYCQHQ-UHFFFAOYSA-K |
| XLogP | 9.77 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.11 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tris[(5,7-dichloroquinolin-8-yl)oxy]alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(5,7-dichloroquinolin-8-yl)oxy]alumane?
The IUPAC name of tris[(5,7-dichloroquinolin-8-yl)oxy]alumane (CID 16685322) is tris[(5,7-dichloroquinolin-8-yl)oxy]alumane.
What is the SMILES notation for tris[(5,7-dichloroquinolin-8-yl)oxy]alumane?
The canonical SMILES for tris[(5,7-dichloroquinolin-8-yl)oxy]alumane is Clc1cc(Cl)c2cccnc2c1O[Al](Oc1c(Cl)cc(Cl)c2cccnc12)Oc1c(Cl)cc(Cl)c2cccnc12.
What is the InChIKey of tris[(5,7-dichloroquinolin-8-yl)oxy]alumane?
The InChIKey is ADGHETHODYCQHQ-UHFFFAOYSA-K. The full InChI is InChI=1S/3C9H5Cl2NO.Al/c3*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h3*1-4,13H;/q;;;+3/p-3.
What are the key properties of tris[(5,7-dichloroquinolin-8-yl)oxy]alumane?
tris[(5,7-dichloroquinolin-8-yl)oxy]alumane has a molecular weight of 666.11 g/mol, XLogP of 9.77, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(5,7-dichloroquinolin-8-yl)oxy]alumane is sourced from PubChem (CID 16685322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).