C31H34N2O4 — CID 166853555
4-[[3-[(3,5-dioxo-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclohexa-1,3-dien-1-yl]methyl]-8-ethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 166853555) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 4-[[3-[(3,5-dioxo-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclohexa-1,3-dien-1-yl]methyl]-8-ethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[3-[(3,5-dioxo-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclohexa-1,3-dien-1-yl]methyl]-8-ethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 166853555 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 4-[[3-[(3,5-dioxo-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclohexa-1,3-dien-1-yl]methyl]-8-ethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCC1=CC2CC1C1C(=O)N(CC3=CCCC(CN4C(=O)C5C6C=C(CC)C(C6)C5C4=O)=C3)C(=O)C21 |
| InChI | InChI=1S/C31H34N2O4/c1-3-6-19-11-21-13-23(19)27-25(21)29(35)33(31(27)37)15-17-8-5-7-16(9-17)14-32-28(34)24-20-10-18(4-2)22(12-20)26(24)30(32)36/h3,8-11,20-27H,1,4-7,12-15H2,2H3 |
| InChIKey | FNHXBVLHIVCGDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|