About bis(2,2-dimethylpropoxy)tin
bis(2,2-dimethylpropoxy)tin (PubChem CID 16685359) has the molecular formula C10H22O2Sn
and a molecular weight of 293.00 g/mol. Its IUPAC name is bis(2,2-dimethylpropoxy)tin.
Molecular Properties
| Compound Name | bis(2,2-dimethylpropoxy)tin |
| PubChem CID | 16685359 |
| Molecular Formula | C10H22O2Sn |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | bis(2,2-dimethylpropoxy)tin |
| SMILES | CC(C)(C)CO[Sn]OCC(C)(C)C |
| InChI | InChI=1S/2C5H11O.Sn/c2*1-5(2,3)4-6;/h2*4H2,1-3H3;/q2*-1;+2 |
| InChIKey | QQZDQFOVPOGLIF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2-dimethylpropoxy)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropoxy)tin?
The IUPAC name of bis(2,2-dimethylpropoxy)tin (CID 16685359) is bis(2,2-dimethylpropoxy)tin.
What is the SMILES notation for bis(2,2-dimethylpropoxy)tin?
The canonical SMILES for bis(2,2-dimethylpropoxy)tin is CC(C)(C)CO[Sn]OCC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpropoxy)tin?
The InChIKey is QQZDQFOVPOGLIF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11O.Sn/c2*1-5(2,3)4-6;/h2*4H2,1-3H3;/q2*-1;+2.
What are the key properties of bis(2,2-dimethylpropoxy)tin?
bis(2,2-dimethylpropoxy)tin has a molecular weight of 293.00 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropoxy)tin is sourced from PubChem (CID 16685359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).