About N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine
N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine (PubChem CID 166853883) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine |
| PubChem CID | 166853883 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine |
| SMILES | C=C(/C=C\C)C1CC1NC |
| InChI | InChI=1S/C9H15N/c1-4-5-7(2)8-6-9(8)10-3/h4-5,8-10H,2,6H2,1,3H3/b5-4- |
| InChIKey | SUUUDJYTBFITTO-PLNGDYQASA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine?
The IUPAC name of N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine (CID 166853883) is N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine.
What is the SMILES notation for N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine?
The canonical SMILES for N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine is C=C(/C=C\C)C1CC1NC.
What is the InChIKey of N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine?
The InChIKey is SUUUDJYTBFITTO-PLNGDYQASA-N. The full InChI is InChI=1S/C9H15N/c1-4-5-7(2)8-6-9(8)10-3/h4-5,8-10H,2,6H2,1,3H3/b5-4-.
What are the key properties of N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine?
N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine has a molecular weight of 137.23 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(3Z)-penta-1,3-dien-2-yl]cyclopropan-1-amine is sourced from PubChem (CID 166853883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).