About 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol
3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol (PubChem CID 166853938) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol |
| PubChem CID | 166853938 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol |
| SMILES | C=C(O)C(=C)C1C=C(C(CC)CC)C=CN1 |
| InChI | InChI=1S/C14H21NO/c1-5-12(6-2)13-7-8-15-14(9-13)10(3)11(4)16/h7-9,12,14-16H,3-6H2,1-2H3 |
| InChIKey | ZNCZZBJKKGXMTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol?
The IUPAC name of 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol (CID 166853938) is 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol.
What is the SMILES notation for 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol?
The canonical SMILES for 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol is C=C(O)C(=C)C1C=C(C(CC)CC)C=CN1.
What is the InChIKey of 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol?
The InChIKey is ZNCZZBJKKGXMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-5-12(6-2)13-7-8-15-14(9-13)10(3)11(4)16/h7-9,12,14-16H,3-6H2,1-2H3.
What are the key properties of 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol?
3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol has a molecular weight of 219.33 g/mol, XLogP of 3.46, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pentan-3-yl-1,2-dihydropyridin-2-yl)buta-1,3-dien-2-ol is sourced from PubChem (CID 166853938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).