About (3-amino-1,3-thiazolidin-2-ylidene)cyanamide
(3-amino-1,3-thiazolidin-2-ylidene)cyanamide (PubChem CID 166854526) has the molecular formula C4H6N4S
and a molecular weight of 142.19 g/mol. Its IUPAC name is (3-amino-1,3-thiazolidin-2-ylidene)cyanamide.
Molecular Properties
| Compound Name | (3-amino-1,3-thiazolidin-2-ylidene)cyanamide |
| PubChem CID | 166854526 |
| Molecular Formula | C4H6N4S |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | (3-amino-1,3-thiazolidin-2-ylidene)cyanamide |
| SMILES | N#C/N=C1\SCCN1N |
| InChI | InChI=1S/C4H6N4S/c5-3-7-4-8(6)1-2-9-4/h1-2,6H2/b7-4- |
| InChIKey | ITXDWVRDYOBZLA-DAXSKMNVSA-N |
| XLogP | -0.25 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-1,3-thiazolidin-2-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-1,3-thiazolidin-2-ylidene)cyanamide?
The IUPAC name of (3-amino-1,3-thiazolidin-2-ylidene)cyanamide (CID 166854526) is (3-amino-1,3-thiazolidin-2-ylidene)cyanamide.
What is the SMILES notation for (3-amino-1,3-thiazolidin-2-ylidene)cyanamide?
The canonical SMILES for (3-amino-1,3-thiazolidin-2-ylidene)cyanamide is N#C/N=C1\SCCN1N.
What is the InChIKey of (3-amino-1,3-thiazolidin-2-ylidene)cyanamide?
The InChIKey is ITXDWVRDYOBZLA-DAXSKMNVSA-N. The full InChI is InChI=1S/C4H6N4S/c5-3-7-4-8(6)1-2-9-4/h1-2,6H2/b7-4-.
What are the key properties of (3-amino-1,3-thiazolidin-2-ylidene)cyanamide?
(3-amino-1,3-thiazolidin-2-ylidene)cyanamide has a molecular weight of 142.19 g/mol, XLogP of -0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-1,3-thiazolidin-2-ylidene)cyanamide is sourced from PubChem (CID 166854526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).