About (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate
(2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate (PubChem CID 166854610) has the molecular formula C14H18N4O7
and a molecular weight of 354.32 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate.
Molecular Properties
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate |
| PubChem CID | 166854610 |
| Molecular Formula | C14H18N4O7 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate |
| SMILES | O=C(NCCC(=O)ON1C(=O)CCC1O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H18N4O7/c19-9-1-2-10(20)17(9)8-7-16-14(24)15-6-5-13(23)25-18-11(21)3-4-12(18)22/h1-2,11,21H,3-8H2,(H2,15,16,24) |
| InChIKey | QJZMCPRTDXOYPP-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate?
The IUPAC name of (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate (CID 166854610) is (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate.
What is the SMILES notation for (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate?
The canonical SMILES for (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate is O=C(NCCC(=O)ON1C(=O)CCC1O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate?
The InChIKey is QJZMCPRTDXOYPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O7/c19-9-1-2-10(20)17(9)8-7-16-14(24)15-6-5-13(23)25-18-11(21)3-4-12(18)22/h1-2,11,21H,3-8H2,(H2,15,16,24).
What are the key properties of (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate?
(2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate has a molecular weight of 354.32 g/mol, XLogP of -2.00, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-oxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethylcarbamoylamino]propanoate is sourced from PubChem (CID 166854610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).