C17H26FNO — CID 166854647
1-[(4Z,5Z,7Z)-7-cyclopropyloxy-4-ethylidene-8-fluoroocta-5,7-dienyl]pyrrolidine (PubChem CID 166854647) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-[(4Z,5Z,7Z)-7-cyclopropyloxy-4-ethylidene-8-fluoroocta-5,7-dienyl]pyrrolidine.
| Compound Name | 1-[(4Z,5Z,7Z)-7-cyclopropyloxy-4-ethylidene-8-fluoroocta-5,7-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 166854647 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-[(4Z,5Z,7Z)-7-cyclopropyloxy-4-ethylidene-8-fluoroocta-5,7-dienyl]pyrrolidine |
| SMILES | C/C=C(\C=C/C(=C/F)OC1CC1)CCCN1CCCC1 |
| InChI | InChI=1S/C17H26FNO/c1-2-15(6-5-13-19-11-3-4-12-19)7-8-17(14-18)20-16-9-10-16/h2,7-8,14,16H,3-6,9-13H2,1H3/b8-7-,15-2-,17-14- |
| InChIKey | CTDKCZYFJRSXKO-KYCLDZNFSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|