C15H19FN6O2S — CID 166855112
N'-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-N-hydroxy-4-[2-(methylsulfanylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 166855112) has the molecular formula C15H19FN6O2S and a molecular weight of 366.42 g/mol. Its IUPAC name is N'-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-N-hydroxy-4-[2-(methylsulfanylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-N-hydroxy-4-[2-(methylsulfanylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 166855112 |
| Molecular Formula | C15H19FN6O2S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N'-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-N-hydroxy-4-[2-(methylsulfanylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CSNCCNc1nonc1/C(=N/C1CCc2ccc(F)cc21)NO |
| InChI | InChI=1S/C15H19FN6O2S/c1-25-18-7-6-17-14-13(21-24-22-14)15(20-23)19-12-5-3-9-2-4-10(16)8-11(9)12/h2,4,8,12,18,23H,3,5-7H2,1H3,(H,17,22)(H,19,20) |
| InChIKey | JRUYRFSJBNHSLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|