About (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine
(6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine (PubChem CID 166855528) has the molecular formula C12H22FN
and a molecular weight of 199.31 g/mol. Its IUPAC name is (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine.
Molecular Properties
| Compound Name | (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine |
| PubChem CID | 166855528 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine |
| SMILES | C=C(C)C(C)/C=C/C(N)CCCCF |
| InChI | InChI=1S/C12H22FN/c1-10(2)11(3)7-8-12(14)6-4-5-9-13/h7-8,11-12H,1,4-6,9,14H2,2-3H3/b8-7+ |
| InChIKey | XFRIVZWIIZYQCY-BQYQJAHWSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine?
The IUPAC name of (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine (CID 166855528) is (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine.
What is the SMILES notation for (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine?
The canonical SMILES for (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine is C=C(C)C(C)/C=C/C(N)CCCCF.
What is the InChIKey of (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine?
The InChIKey is XFRIVZWIIZYQCY-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H22FN/c1-10(2)11(3)7-8-12(14)6-4-5-9-13/h7-8,11-12H,1,4-6,9,14H2,2-3H3/b8-7+.
What are the key properties of (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine?
(6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine has a molecular weight of 199.31 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-1-fluoro-8,9-dimethyldeca-6,9-dien-5-amine is sourced from PubChem (CID 166855528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).