About 5-methoxy-2-methylhexa-1,5-dien-3-amine
5-methoxy-2-methylhexa-1,5-dien-3-amine (PubChem CID 166855659) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5-methoxy-2-methylhexa-1,5-dien-3-amine.
Molecular Properties
| Compound Name | 5-methoxy-2-methylhexa-1,5-dien-3-amine |
| PubChem CID | 166855659 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 5-methoxy-2-methylhexa-1,5-dien-3-amine |
| SMILES | C=C(CC(N)C(=C)C)OC |
| InChI | InChI=1S/C8H15NO/c1-6(2)8(9)5-7(3)10-4/h8H,1,3,5,9H2,2,4H3 |
| InChIKey | AWSBIMWAIIFIBZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-methylhexa-1,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methylhexa-1,5-dien-3-amine?
The IUPAC name of 5-methoxy-2-methylhexa-1,5-dien-3-amine (CID 166855659) is 5-methoxy-2-methylhexa-1,5-dien-3-amine.
What is the SMILES notation for 5-methoxy-2-methylhexa-1,5-dien-3-amine?
The canonical SMILES for 5-methoxy-2-methylhexa-1,5-dien-3-amine is C=C(CC(N)C(=C)C)OC.
What is the InChIKey of 5-methoxy-2-methylhexa-1,5-dien-3-amine?
The InChIKey is AWSBIMWAIIFIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-6(2)8(9)5-7(3)10-4/h8H,1,3,5,9H2,2,4H3.
What are the key properties of 5-methoxy-2-methylhexa-1,5-dien-3-amine?
5-methoxy-2-methylhexa-1,5-dien-3-amine has a molecular weight of 141.21 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methylhexa-1,5-dien-3-amine is sourced from PubChem (CID 166855659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).