About N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine
N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine (PubChem CID 166855666) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine |
| PubChem CID | 166855666 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine |
| SMILES | C=C(CC)C(=C)CCNCCOC |
| InChI | InChI=1S/C11H21NO/c1-5-10(2)11(3)6-7-12-8-9-13-4/h12H,2-3,5-9H2,1,4H3 |
| InChIKey | UUHYJYSKXWIVPJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine?
The IUPAC name of N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine (CID 166855666) is N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine.
What is the SMILES notation for N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine?
The canonical SMILES for N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine is C=C(CC)C(=C)CCNCCOC.
What is the InChIKey of N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine?
The InChIKey is UUHYJYSKXWIVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-5-10(2)11(3)6-7-12-8-9-13-4/h12H,2-3,5-9H2,1,4H3.
What are the key properties of N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine?
N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine has a molecular weight of 183.29 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-3,4-dimethylidenehexan-1-amine is sourced from PubChem (CID 166855666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).