C8H14Cl6O4Sn2 — CID 16685627
2,2,6,6-tetramethyl-4,8-bis(trichloromethyl)-1,3,5,7,2,6-tetraoxadistannocane (PubChem CID 16685627) has the molecular formula C8H14Cl6O4Sn2 and a molecular weight of 624.34 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4,8-bis(trichloromethyl)-1,3,5,7,2,6-tetraoxadistannocane.
| Compound Name | 2,2,6,6-tetramethyl-4,8-bis(trichloromethyl)-1,3,5,7,2,6-tetraoxadistannocane |
|---|---|
| PubChem CID | 16685627 |
| Molecular Formula | C8H14Cl6O4Sn2 |
| Molecular Weight | 624.34 g/mol |
| Exact Mass | 623.71 |
| IUPAC Name | 2,2,6,6-tetramethyl-4,8-bis(trichloromethyl)-1,3,5,7,2,6-tetraoxadistannocane |
| SMILES | C[Sn]1(C)OC(C(Cl)(Cl)Cl)O[Sn](C)(C)OC(C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/2C2HCl3O2.4CH3.2Sn/c2*3-2(4,5)1(6)7;;;;;;/h2*1H;4*1H3;;/q2*-2;;;;;2*+2 |
| InChIKey | AJDKTYLMGCHXJR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|