About 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol
2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol (PubChem CID 166857452) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol.
Molecular Properties
| Compound Name | 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol |
| PubChem CID | 166857452 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol |
| SMILES | C=C(CC)C(OCCS)C(=C)CC |
| InChI | InChI=1S/C11H20OS/c1-5-9(3)11(10(4)6-2)12-7-8-13/h11,13H,3-8H2,1-2H3 |
| InChIKey | VOQNXSNOXSRSHF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol?
The IUPAC name of 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol (CID 166857452) is 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol.
What is the SMILES notation for 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol?
The canonical SMILES for 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol is C=C(CC)C(OCCS)C(=C)CC.
What is the InChIKey of 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol?
The InChIKey is VOQNXSNOXSRSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-5-9(3)11(10(4)6-2)12-7-8-13/h11,13H,3-8H2,1-2H3.
What are the key properties of 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol?
2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol has a molecular weight of 200.35 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylideneheptan-4-yloxy)ethanethiol is sourced from PubChem (CID 166857452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).