C27H54N2 — CID 166857825
N'-tert-butyl-N-methyl-N'-(5,5,7-trimethyl-6-methylideneoct-1-en-2-yl)decane-1,10-diamine (PubChem CID 166857825) has the molecular formula C27H54N2 and a molecular weight of 406.74 g/mol. Its IUPAC name is N'-tert-butyl-N-methyl-N'-(5,5,7-trimethyl-6-methylideneoct-1-en-2-yl)decane-1,10-diamine.
| Compound Name | N'-tert-butyl-N-methyl-N'-(5,5,7-trimethyl-6-methylideneoct-1-en-2-yl)decane-1,10-diamine |
|---|---|
| PubChem CID | 166857825 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | N'-tert-butyl-N-methyl-N'-(5,5,7-trimethyl-6-methylideneoct-1-en-2-yl)decane-1,10-diamine |
| SMILES | C=C(CCC(C)(C)C(=C)C(C)C)N(CCCCCCCCCCNC)C(C)(C)C |
| InChI | InChI=1S/C27H54N2/c1-23(2)25(4)27(8,9)20-19-24(3)29(26(5,6)7)22-18-16-14-12-11-13-15-17-21-28-10/h23,28H,3-4,11-22H2,1-2,5-10H3 |
| InChIKey | OHBDXNAFQGLMOZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|