C16H16FN3O2S — CID 166858340
7-fluoro-1,1-dioxo-N-(3-phenylpropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 166858340) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 7-fluoro-1,1-dioxo-N-(3-phenylpropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-fluoro-1,1-dioxo-N-(3-phenylpropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 166858340 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 7-fluoro-1,1-dioxo-N-(3-phenylpropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N/CCCc2ccccc2)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C16H16FN3O2S/c17-13-8-9-14-15(11-13)23(21,22)20-16(19-14)18-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H2,18,19,20) |
| InChIKey | RLDNUVKIBDNNFK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|