C8H15N3 — CID 166858642
1,1-bis(azetidin-1-yl)-N-methylmethanimine (PubChem CID 166858642) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1,1-bis(azetidin-1-yl)-N-methylmethanimine.
| Compound Name | 1,1-bis(azetidin-1-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 166858642 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1,1-bis(azetidin-1-yl)-N-methylmethanimine |
| SMILES | CN=C(N1CCC1)N1CCC1 |
| InChI | InChI=1S/C8H15N3/c1-9-8(10-4-2-5-10)11-6-3-7-11/h2-7H2,1H3 |
| InChIKey | GQOGODGNMFGVBY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|