About 4-(3-methylheptylamino)-N'-propylbenzohydrazide
4-(3-methylheptylamino)-N'-propylbenzohydrazide (PubChem CID 166858690) has the molecular formula C18H31N3O
and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-(3-methylheptylamino)-N'-propylbenzohydrazide.
Molecular Properties
| Compound Name | 4-(3-methylheptylamino)-N'-propylbenzohydrazide |
| PubChem CID | 166858690 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 4-(3-methylheptylamino)-N'-propylbenzohydrazide |
| SMILES | CCCCC(C)CCNc1ccc(C(=O)NNCCC)cc1 |
| InChI | InChI=1S/C18H31N3O/c1-4-6-7-15(3)12-14-19-17-10-8-16(9-11-17)18(22)21-20-13-5-2/h8-11,15,19-20H,4-7,12-14H2,1-3H3,(H,21,22) |
| InChIKey | KQVSQPIAZPMZQO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylheptylamino)-N'-propylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylheptylamino)-N'-propylbenzohydrazide?
The IUPAC name of 4-(3-methylheptylamino)-N'-propylbenzohydrazide (CID 166858690) is 4-(3-methylheptylamino)-N'-propylbenzohydrazide.
What is the SMILES notation for 4-(3-methylheptylamino)-N'-propylbenzohydrazide?
The canonical SMILES for 4-(3-methylheptylamino)-N'-propylbenzohydrazide is CCCCC(C)CCNc1ccc(C(=O)NNCCC)cc1.
What is the InChIKey of 4-(3-methylheptylamino)-N'-propylbenzohydrazide?
The InChIKey is KQVSQPIAZPMZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O/c1-4-6-7-15(3)12-14-19-17-10-8-16(9-11-17)18(22)21-20-13-5-2/h8-11,15,19-20H,4-7,12-14H2,1-3H3,(H,21,22).
What are the key properties of 4-(3-methylheptylamino)-N'-propylbenzohydrazide?
4-(3-methylheptylamino)-N'-propylbenzohydrazide has a molecular weight of 305.47 g/mol, XLogP of 3.96, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylheptylamino)-N'-propylbenzohydrazide is sourced from PubChem (CID 166858690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).