About N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine
N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine (PubChem CID 166858747) has the molecular formula C14H21F6N3
and a molecular weight of 345.33 g/mol. Its IUPAC name is N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine.
Molecular Properties
| Compound Name | N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine |
| PubChem CID | 166858747 |
| Molecular Formula | C14H21F6N3 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine |
| SMILES | CN=C(N1CCC(C(F)(F)F)CC1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21F6N3/c1-21-12(22-6-2-10(3-7-22)13(15,16)17)23-8-4-11(5-9-23)14(18,19)20/h10-11H,2-9H2,1H3 |
| InChIKey | FASBTJJEKNPVOC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine?
The IUPAC name of N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine (CID 166858747) is N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine.
What is the SMILES notation for N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine?
The canonical SMILES for N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine is CN=C(N1CCC(C(F)(F)F)CC1)N1CCC(C(F)(F)F)CC1.
What is the InChIKey of N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine?
The InChIKey is FASBTJJEKNPVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F6N3/c1-21-12(22-6-2-10(3-7-22)13(15,16)17)23-8-4-11(5-9-23)14(18,19)20/h10-11H,2-9H2,1H3.
What are the key properties of N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine?
N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine has a molecular weight of 345.33 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,1-bis[4-(trifluoromethyl)piperidin-1-yl]methanimine is sourced from PubChem (CID 166858747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).