C25H36N6 — CID 166858901
(2Z)-N,2-dimethyl-1-[(2R,6S)-1-methyl-6-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-2-yl]penta-2,4-dien-1-imine (PubChem CID 166858901) has the molecular formula C25H36N6 and a molecular weight of 420.61 g/mol. Its IUPAC name is (2Z)-N,2-dimethyl-1-[(2R,6S)-1-methyl-6-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-2-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-N,2-dimethyl-1-[(2R,6S)-1-methyl-6-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-2-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166858901 |
| Molecular Formula | C25H36N6 |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2Z)-N,2-dimethyl-1-[(2R,6S)-1-methyl-6-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-2-yl]penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(C)\C(=N/C)[C@H]1CCC[C@@H](c2nc3c(N4CCN(C)CC4)cccc3[nH]2)N1C |
| InChI | InChI=1S/C25H36N6/c1-6-9-18(2)23(26-3)20-11-8-13-22(30(20)5)25-27-19-10-7-12-21(24(19)28-25)31-16-14-29(4)15-17-31/h6-7,9-10,12,20,22H,1,8,11,13-17H2,2-5H3,(H,27,28)/b18-9-,26-23+/t20-,22+/m1/s1 |
| InChIKey | SSWNBEBMCAJZMQ-KWKIIESYSA-N |
| XLogP | 4.04 |
| TPSA | 50.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|